C21H25N5O7S — CID 70430517
(4-nitrophenyl)methyl (2S,3S,5S)-3-[(5-butyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70430517) has the molecular formula C21H25N5O7S and a molecular weight of 491.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3S,5S)-3-[(5-butyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-[(5-butyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70430517 |
| Molecular Formula | C21H25N5O7S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-[(5-butyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCc1cnnn1C[C@@]1(C)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C21H25N5O7S/c1-3-4-5-16-11-22-23-24(16)13-21(2)19(25-17(27)10-18(25)34(21,31)32)20(28)33-12-14-6-8-15(9-7-14)26(29)30/h6-9,11,18-19H,3-5,10,12-13H2,1-2H3/t18-,19-,21-/m0/s1 |
| InChIKey | IDZABKODAZHBBM-ZJOUEHCJSA-N |
| XLogP | 1.39 |
| TPSA | 154.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|