C19H20N2O9S — CID 11762172
3-O,3-O'-diethyl 2-O-[(4-nitrophenyl)methyl] (2S,5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2,3,3-tricarboxylate (PubChem CID 11762172) has the molecular formula C19H20N2O9S and a molecular weight of 452.44 g/mol. Its IUPAC name is 3-O,3-O'-diethyl 2-O-[(4-nitrophenyl)methyl] (2S,5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2,3,3-tricarboxylate.
| Compound Name | 3-O,3-O'-diethyl 2-O-[(4-nitrophenyl)methyl] (2S,5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2,3,3-tricarboxylate |
|---|---|
| PubChem CID | 11762172 |
| Molecular Formula | C19H20N2O9S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-O,3-O'-diethyl 2-O-[(4-nitrophenyl)methyl] (2S,5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2,3,3-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)S[C@@H]2CC(=O)N2[C@H]1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N2O9S/c1-3-28-17(24)19(18(25)29-4-2)15(20-13(22)9-14(20)31-19)16(23)30-10-11-5-7-12(8-6-11)21(26)27/h5-8,14-15H,3-4,9-10H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | GCNHZKSGCSEODH-CABCVRRESA-N |
| XLogP | 1.18 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|