C21H19N5O7S — CID 56630869
(4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-7-oxo-3-[(4-prop-2-ynoxycarbonyltriazol-1-yl)methyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 56630869) has the molecular formula C21H19N5O7S and a molecular weight of 485.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-7-oxo-3-[(4-prop-2-ynoxycarbonyltriazol-1-yl)methyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-7-oxo-3-[(4-prop-2-ynoxycarbonyltriazol-1-yl)methyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 56630869 |
| Molecular Formula | C21H19N5O7S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-7-oxo-3-[(4-prop-2-ynoxycarbonyltriazol-1-yl)methyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C#CCOC(=O)c1cn(C[C@]2(C)S[C@H]3CC(=O)N3[C@H]2C(=O)OCc2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C21H19N5O7S/c1-3-8-32-19(28)15-10-24(23-22-15)12-21(2)18(25-16(27)9-17(25)34-21)20(29)33-11-13-4-6-14(7-5-13)26(30)31/h1,4-7,10,17-18H,8-9,11-12H2,2H3/t17-,18-,21-/m0/s1 |
| InChIKey | SUMFHKCSLADIIT-WFXMLNOXSA-N |
| XLogP | 1.15 |
| TPSA | 146.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|