C21H21N5O9S — CID 14769712
dimethyl 1-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate (PubChem CID 14769712) has the molecular formula C21H21N5O9S and a molecular weight of 519.49 g/mol. Its IUPAC name is dimethyl 1-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 14769712 |
| Molecular Formula | C21H21N5O9S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | dimethyl 1-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(C[C@]2(C)S[C@@H]3CC(=O)N3[C@H]2C(=O)OCc2ccc([N+](=O)[O-])cc2)c1C(=O)OC |
| InChI | InChI=1S/C21H21N5O9S/c1-21(10-24-16(19(29)34-3)15(22-23-24)18(28)33-2)17(25-13(27)8-14(25)36-21)20(30)35-9-11-4-6-12(7-5-11)26(31)32/h4-7,14,17H,8-10H2,1-3H3/t14-,17+,21+/m1/s1 |
| InChIKey | DPYMBRMNTRIPRZ-FNXXIHLHSA-N |
| XLogP | 0.94 |
| TPSA | 173.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|