C23H21N5O7S — CID 18607937
(4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-phenyltriazol-1-yl)methyl]-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 18607937) has the molecular formula C23H21N5O7S and a molecular weight of 511.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-phenyltriazol-1-yl)methyl]-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-phenyltriazol-1-yl)methyl]-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18607937 |
| Molecular Formula | C23H21N5O7S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-phenyltriazol-1-yl)methyl]-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(Cn2nncc2-c2ccccc2)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C23H21N5O7S/c1-23(14-26-18(12-24-25-26)16-5-3-2-4-6-16)21(27-19(29)11-20(27)36(23,33)34)22(30)35-13-15-7-9-17(10-8-15)28(31)32/h2-10,12,20-21H,11,13-14H2,1H3/t20-,21-,23-/m0/s1 |
| InChIKey | JWLWYKZGGFWGNM-FUDKSRODSA-N |
| XLogP | 1.71 |
| TPSA | 154.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|