C18H20N2O7S — CID 70526131
(4-nitrophenyl)methyl 3-(2-acetyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70526131) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(2-acetyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-(2-acetyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70526131 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(2-acetyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)OCCSC1CC2CC(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O7S/c1-11(21)26-6-7-28-15-8-14-9-16(22)19(14)17(15)18(23)27-10-12-2-4-13(5-3-12)20(24)25/h2-5,14-15,17H,6-10H2,1H3 |
| InChIKey | ZBIWUCRUVMXFER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|