C20H24N2O7S — CID 70533103
(4-nitrophenyl)methyl 2-(2-acetyloxyethyl)-3-ethylsulfanyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70533103) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(2-acetyloxyethyl)-3-ethylsulfanyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-(2-acetyloxyethyl)-3-ethylsulfanyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70533103 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(2-acetyloxyethyl)-3-ethylsulfanyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCSC1CC2CC(=O)N2C1(CCOC(C)=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-3-30-17-10-16-11-18(24)21(16)20(17,8-9-28-13(2)23)19(25)29-12-14-4-6-15(7-5-14)22(26)27/h4-7,16-17H,3,8-12H2,1-2H3 |
| InChIKey | VQTXNWVNHGXZML-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|