C21H26N2O7S2 — CID 70417023
(4-nitrophenyl)methyl 3-(2-ethoxyethylsulfanyl)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-4-oxopent-2-enoate (PubChem CID 70417023) has the molecular formula C21H26N2O7S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(2-ethoxyethylsulfanyl)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-4-oxopent-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-(2-ethoxyethylsulfanyl)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 70417023 |
| Molecular Formula | C21H26N2O7S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(2-ethoxyethylsulfanyl)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-4-oxopent-2-enoate |
| SMILES | CCOCCSC(C(C)=O)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)CC1SCC |
| InChI | InChI=1S/C21H26N2O7S2/c1-4-29-10-11-32-20(14(3)24)19(22-17(25)12-18(22)31-5-2)21(26)30-13-15-6-8-16(9-7-15)23(27)28/h6-9,18H,4-5,10-13H2,1-3H3 |
| InChIKey | OOEVVOWWABPJSU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|