C16H17ClN2O6 — CID 70611156
(4-nitrophenyl)methyl (E)-2-(2-chloro-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate (PubChem CID 70611156) has the molecular formula C16H17ClN2O6 and a molecular weight of 368.77 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-(2-chloro-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-(2-chloro-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate |
|---|---|
| PubChem CID | 70611156 |
| Molecular Formula | C16H17ClN2O6 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-(2-chloro-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate |
| SMILES | CC/C(OC)=C(/C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)CC1Cl |
| InChI | InChI=1S/C16H17ClN2O6/c1-3-12(24-2)15(18-13(17)8-14(18)20)16(21)25-9-10-4-6-11(7-5-10)19(22)23/h4-7,13H,3,8-9H2,1-2H3/b15-12+ |
| InChIKey | FQQZKFWZICSQPO-NTCAYCPXSA-N |
| XLogP | 2.70 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|