C20H23F3N2O8S2 — CID 88798127
(4-nitrophenyl)methyl (E)-2-(2-butylsulfanyl-4-oxoazetidin-1-yl)-3-(trifluoromethylsulfonyloxy)pent-2-enoate (PubChem CID 88798127) has the molecular formula C20H23F3N2O8S2 and a molecular weight of 540.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-(2-butylsulfanyl-4-oxoazetidin-1-yl)-3-(trifluoromethylsulfonyloxy)pent-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-(2-butylsulfanyl-4-oxoazetidin-1-yl)-3-(trifluoromethylsulfonyloxy)pent-2-enoate |
|---|---|
| PubChem CID | 88798127 |
| Molecular Formula | C20H23F3N2O8S2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-(2-butylsulfanyl-4-oxoazetidin-1-yl)-3-(trifluoromethylsulfonyloxy)pent-2-enoate |
| SMILES | CCCCSC1CC(=O)N1/C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(\CC)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O8S2/c1-3-5-10-34-17-11-16(26)24(17)18(15(4-2)33-35(30,31)20(21,22)23)19(27)32-12-13-6-8-14(9-7-13)25(28)29/h6-9,17H,3-5,10-12H2,1-2H3/b18-15+ |
| InChIKey | DEKRJDSHZJKQOY-OBGWFSINSA-N |
| XLogP | 4.22 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|