C18H21ClN2O6S — CID 88697364
(4-nitrophenyl)methyl 2-chloro-2-[(2R)-2-hexanoylsulfanyl-4-oxoazetidin-1-yl]acetate (PubChem CID 88697364) has the molecular formula C18H21ClN2O6S and a molecular weight of 428.89 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-chloro-2-[(2R)-2-hexanoylsulfanyl-4-oxoazetidin-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-chloro-2-[(2R)-2-hexanoylsulfanyl-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 88697364 |
| Molecular Formula | C18H21ClN2O6S |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (4-nitrophenyl)methyl 2-chloro-2-[(2R)-2-hexanoylsulfanyl-4-oxoazetidin-1-yl]acetate |
| SMILES | CCCCCC(=O)S[C@@H]1CC(=O)N1C(Cl)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21ClN2O6S/c1-2-3-4-5-16(23)28-15-10-14(22)20(15)17(19)18(24)27-11-12-6-8-13(9-7-12)21(25)26/h6-9,15,17H,2-5,10-11H2,1H3/t15-,17?/m1/s1 |
| InChIKey | CZDFYMXIZNUJSS-LDCVWXEPSA-N |
| XLogP | 3.60 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|