C21H27N5O6S — CID 14460323
(4-nitrophenyl)methyl 5-azido-2-(2-tert-butylsulfanyl-4-oxoazetidin-1-yl)-4,4-dimethyl-3-oxopentanoate (PubChem CID 14460323) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-azido-2-(2-tert-butylsulfanyl-4-oxoazetidin-1-yl)-4,4-dimethyl-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 5-azido-2-(2-tert-butylsulfanyl-4-oxoazetidin-1-yl)-4,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 14460323 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (4-nitrophenyl)methyl 5-azido-2-(2-tert-butylsulfanyl-4-oxoazetidin-1-yl)-4,4-dimethyl-3-oxopentanoate |
| SMILES | CC(C)(C)SC1CC(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)C(C)(C)CN=[N+]=[N-] |
| InChI | InChI=1S/C21H27N5O6S/c1-20(2,3)33-16-10-15(27)25(16)17(18(28)21(4,5)12-23-24-22)19(29)32-11-13-6-8-14(9-7-13)26(30)31/h6-9,16-17H,10-12H2,1-5H3 |
| InChIKey | CTJZEJGWJVZHKT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 155.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|