C28H31N3O11S — CID 11410979
(4-nitrophenyl)methyl 4,4-dimethyl-2-[(2R,3S)-2-methylsulfanyl-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-oxopentanoate (PubChem CID 11410979) has the molecular formula C28H31N3O11S and a molecular weight of 617.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4,4-dimethyl-2-[(2R,3S)-2-methylsulfanyl-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 4,4-dimethyl-2-[(2R,3S)-2-methylsulfanyl-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 11410979 |
| Molecular Formula | C28H31N3O11S |
| Molecular Weight | 617.63 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | (4-nitrophenyl)methyl 4,4-dimethyl-2-[(2R,3S)-2-methylsulfanyl-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-oxopentanoate |
| SMILES | CS[C@@H]1[C@@H]([C@H](C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)C(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C28H31N3O11S/c1-16(42-27(35)41-15-18-8-12-20(13-9-18)31(38)39)21-24(33)29(25(21)43-5)22(23(32)28(2,3)4)26(34)40-14-17-6-10-19(11-7-17)30(36)37/h6-13,16,21-22,25H,14-15H2,1-5H3/t16-,21-,22?,25+/m0/s1 |
| InChIKey | MWGJBWLWMOMFGG-BSRUEIDLSA-N |
| XLogP | 4.42 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|