C17H18N2O9S — CID 56978604
S-[(2S,3S)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl] 3-hydroxy-2-oxobutanethioate (PubChem CID 56978604) has the molecular formula C17H18N2O9S and a molecular weight of 426.40 g/mol. Its IUPAC name is S-[(2S,3S)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl] 3-hydroxy-2-oxobutanethioate.
| Compound Name | S-[(2S,3S)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl] 3-hydroxy-2-oxobutanethioate |
|---|---|
| PubChem CID | 56978604 |
| Molecular Formula | C17H18N2O9S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | S-[(2S,3S)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl] 3-hydroxy-2-oxobutanethioate |
| SMILES | CC(O)C(=O)C(=O)S[C@@H]1NC(=O)[C@@H]1C(C)OC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O9S/c1-8(20)13(21)16(23)29-15-12(14(22)18-15)9(2)28-17(24)27-7-10-3-5-11(6-4-10)19(25)26/h3-6,8-9,12,15,20H,7H2,1-2H3,(H,18,22)/t8?,9?,12-,15-/m0/s1 |
| InChIKey | NXSRFQFOCSSROS-BJQCUBDTSA-N |
| XLogP | 0.92 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|