C23H19N3O10S — CID 154413793
(5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-3-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154413793) has the molecular formula C23H19N3O10S and a molecular weight of 529.48 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-3-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-3-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154413793 |
| Molecular Formula | C23H19N3O10S |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-3-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](OC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N2C(C(=O)O)=C(Cc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C23H19N3O10S/c1-12(36-23(30)35-11-14-4-8-16(9-5-14)26(33)34)18-20(27)24-19(22(28)29)17(37-21(18)24)10-13-2-6-15(7-3-13)25(31)32/h2-9,12,18,21H,10-11H2,1H3,(H,28,29)/t12-,18+,21-/m1/s1 |
| InChIKey | HEEYCMXWEBVCHP-CECALHEMSA-N |
| XLogP | 3.61 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|