C25H24N2O8S — CID 70506763
benzyl (6R,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70506763) has the molecular formula C25H24N2O8S and a molecular weight of 512.54 g/mol. Its IUPAC name is benzyl (6R,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6R,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70506763 |
| Molecular Formula | C25H24N2O8S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | benzyl (6R,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)N2C(=O)[C@H](C(C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C25H24N2O8S/c1-15-14-36-23-20(16(2)35-25(30)34-13-18-8-10-19(11-9-18)27(31)32)22(28)26(23)21(15)24(29)33-12-17-6-4-3-5-7-17/h3-11,16,20,23H,12-14H2,1-2H3/t16?,20-,23+/m0/s1 |
| InChIKey | KTPYIJVBCOXURW-LQERJKSESA-N |
| XLogP | 4.19 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|