C29H30N2O9 — CID 10578592
benzyl (1S,5R,8aS,8bR)-5-methoxy-1-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 10578592) has the molecular formula C29H30N2O9 and a molecular weight of 550.56 g/mol. Its IUPAC name is benzyl (1S,5R,8aS,8bR)-5-methoxy-1-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | benzyl (1S,5R,8aS,8bR)-5-methoxy-1-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 10578592 |
| Molecular Formula | C29H30N2O9 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | benzyl (1S,5R,8aS,8bR)-5-methoxy-1-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CO[C@@H]1CCC[C@H]2C1=C(C(=O)OCc1ccccc1)N1C(=O)[C@H]([C@@H](C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@H]21 |
| InChI | InChI=1S/C29H30N2O9/c1-17(40-29(34)39-16-19-11-13-20(14-12-19)31(35)36)23-25-21-9-6-10-22(37-2)24(21)26(30(25)27(23)32)28(33)38-15-18-7-4-3-5-8-18/h3-5,7-8,11-14,17,21-23,25H,6,9-10,15-16H2,1-2H3/t17-,21+,22-,23-,25-/m1/s1 |
| InChIKey | HWSNAPXVVZLGLN-VQCAUGQLSA-N |
| XLogP | 4.29 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|