C26H24N4O10S — CID 173424941
benzyl (6R,7S)-4-diazo-3-ethoxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 173424941) has the molecular formula C26H24N4O10S and a molecular weight of 584.56 g/mol. Its IUPAC name is benzyl (6R,7S)-4-diazo-3-ethoxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6R,7S)-4-diazo-3-ethoxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 173424941 |
| Molecular Formula | C26H24N4O10S |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | benzyl (6R,7S)-4-diazo-3-ethoxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC1=C(C(=O)OCc2ccccc2)N2C(=O)[C@H](C(C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@H]2S(=O)C1=[N+]=[N-] |
| InChI | InChI=1S/C26H24N4O10S/c1-3-37-21-20(25(32)38-13-16-7-5-4-6-8-16)29-23(31)19(24(29)41(36)22(21)28-27)15(2)40-26(33)39-14-17-9-11-18(12-10-17)30(34)35/h4-12,15,19,24H,3,13-14H2,1-2H3/t15?,19-,24+,41?/m0/s1 |
| InChIKey | MTUPSNGJOZIMEZ-BDPBEENRSA-N |
| XLogP | 2.80 |
| TPSA | 187.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|