C24H26N4O11S — CID 54066193
2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-4-diazo-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54066193) has the molecular formula C24H26N4O11S and a molecular weight of 578.56 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-4-diazo-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-4-diazo-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54066193 |
| Molecular Formula | C24H26N4O11S |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-4-diazo-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCOC(=O)C(C)(C)C)N2C(=O)[C@H](C(C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@H]2[S@@](=O)C1=[N+]=[N-] |
| InChI | InChI=1S/C24H26N4O11S/c1-12-17(21(30)37-11-38-22(31)24(3,4)5)27-19(29)16(20(27)40(35)18(12)26-25)13(2)39-23(32)36-10-14-6-8-15(9-7-14)28(33)34/h6-9,13,16,20H,10-11H2,1-5H3/t13?,16-,20-,40-/m0/s1 |
| InChIKey | MDDZIIUSKMTLMQ-PWQCUUMWSA-N |
| XLogP | 2.18 |
| TPSA | 205.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|