C20H20N4O9S2 — CID 56613317
(5R,6S,7S)-4-diazo-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-3-propylsulfanyl-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56613317) has the molecular formula C20H20N4O9S2 and a molecular weight of 524.53 g/mol. Its IUPAC name is (5R,6S,7S)-4-diazo-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-3-propylsulfanyl-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S,7S)-4-diazo-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-3-propylsulfanyl-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56613317 |
| Molecular Formula | C20H20N4O9S2 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | (5R,6S,7S)-4-diazo-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-3-propylsulfanyl-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCSC1=C(C(=O)O)N2C(=O)[C@H](C(C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@H]2[S@@](=O)C1=[N+]=[N-] |
| InChI | InChI=1S/C20H20N4O9S2/c1-3-8-34-15-14(19(26)27)23-17(25)13(18(23)35(31)16(15)22-21)10(2)33-20(28)32-9-11-4-6-12(7-5-11)24(29)30/h4-7,10,13,18H,3,8-9H2,1-2H3,(H,26,27)/t10?,13-,18-,35-/m0/s1 |
| InChIKey | BXPMUTSXKQVNDR-SYMNCURCSA-N |
| XLogP | 2.25 |
| TPSA | 189.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|