C27H26N2O9S2 — CID 70507829
benzyl (6S,7S)-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-3-propylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70507829) has the molecular formula C27H26N2O9S2 and a molecular weight of 586.64 g/mol. Its IUPAC name is benzyl (6S,7S)-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-3-propylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6S,7S)-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-3-propylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70507829 |
| Molecular Formula | C27H26N2O9S2 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | benzyl (6S,7S)-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-3-propylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCSC1=C(C(=O)OCc2ccccc2)N2C(=O)[C@H]([C@@H](C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@H]2SC1=O |
| InChI | InChI=1S/C27H26N2O9S2/c1-3-13-39-22-21(25(31)36-14-17-7-5-4-6-8-17)28-23(30)20(24(28)40-26(22)32)16(2)38-27(33)37-15-18-9-11-19(12-10-18)29(34)35/h4-12,16,20,24H,3,13-15H2,1-2H3/t16-,20+,24+/m1/s1 |
| InChIKey | WBBKHSRRQRMIKB-NKNQFRNOSA-N |
| XLogP | 4.79 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|