C25H22N2O9S — CID 88771315
benzyl (6S,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]-2-oxoethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88771315) has the molecular formula C25H22N2O9S and a molecular weight of 526.52 g/mol. Its IUPAC name is benzyl (6S,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]-2-oxoethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6S,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]-2-oxoethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88771315 |
| Molecular Formula | C25H22N2O9S |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | benzyl (6S,7S)-3-methyl-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]-2-oxoethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)N2C(=O)[C@H](C(C=O)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@H]2SC1 |
| InChI | InChI=1S/C25H22N2O9S/c1-15-14-37-23-20(22(29)26(23)21(15)24(30)34-12-16-5-3-2-4-6-16)19(11-28)36-25(31)35-13-17-7-9-18(10-8-17)27(32)33/h2-11,19-20,23H,12-14H2,1H3/t19?,20-,23-/m0/s1 |
| InChIKey | LLOJVFOYTUOHIE-MQBGSOHWSA-N |
| XLogP | 3.36 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|