C24H20N2O10S — CID 70507877
benzyl (6S,7S)-3-hydroxy-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70507877) has the molecular formula C24H20N2O10S and a molecular weight of 528.50 g/mol. Its IUPAC name is benzyl (6S,7S)-3-hydroxy-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6S,7S)-3-hydroxy-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70507877 |
| Molecular Formula | C24H20N2O10S |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | benzyl (6S,7S)-3-hydroxy-7-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N2C(C(=O)OCc3ccccc3)=C(O)C(=O)S[C@@H]12 |
| InChI | InChI=1S/C24H20N2O10S/c1-13(36-24(31)35-12-15-7-9-16(10-8-15)26(32)33)17-20(28)25-18(19(27)23(30)37-21(17)25)22(29)34-11-14-5-3-2-4-6-14/h2-10,13,17,21,27H,11-12H2,1H3/t13-,17+,21+/m1/s1 |
| InChIKey | YSVYUIOJVTTWNN-JRQSSSKMSA-N |
| XLogP | 3.21 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|