C25H24N2O12S2 — CID 88718400
benzyl (6R,7S)-3-methylsulfonyloxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88718400) has the molecular formula C25H24N2O12S2 and a molecular weight of 608.60 g/mol. Its IUPAC name is benzyl (6R,7S)-3-methylsulfonyloxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzyl (6R,7S)-3-methylsulfonyloxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88718400 |
| Molecular Formula | C25H24N2O12S2 |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | benzyl (6R,7S)-3-methylsulfonyloxy-7-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(OC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N2C(C(=O)OCc3ccccc3)=C(OS(C)(=O)=O)CS(=O)[C@H]12 |
| InChI | InChI=1S/C25H24N2O12S2/c1-15(38-25(30)37-13-17-8-10-18(11-9-17)27(31)32)20-22(28)26-21(24(29)36-12-16-6-4-3-5-7-16)19(39-41(2,34)35)14-40(33)23(20)26/h3-11,15,20,23H,12-14H2,1-2H3/t15?,20-,23+,40?/m0/s1 |
| InChIKey | AZCBPCZYCPWROT-HVXICMCRSA-N |
| XLogP | 2.11 |
| TPSA | 185.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|