C18H18N2O8S — CID 70452427
(5R,6S)-6-[(1S)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70452427) has the molecular formula C18H18N2O8S and a molecular weight of 422.42 g/mol. Its IUPAC name is (5R,6S)-6-[(1S)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1S)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70452427 |
| Molecular Formula | C18H18N2O8S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (5R,6S)-6-[(1S)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SCC(=O)OCc3ccc([N+](=O)[O-])cc3)C[C@H]12 |
| InChI | InChI=1S/C18H18N2O8S/c1-9(21)15-12-6-13(16(18(24)25)19(12)17(15)23)29-8-14(22)28-7-10-2-4-11(5-3-10)20(26)27/h2-5,9,12,15,21H,6-8H2,1H3,(H,24,25)/t9-,12+,15+/m0/s1 |
| InChIKey | ZVXJVSUVJPSHFN-TURKWSHLSA-N |
| XLogP | 1.28 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|