C24H26ClN3O7S — CID 70449669
(4-nitrophenyl)methyl 6-[(1R)-1-hydroxyethyl]-3-[2-(3-methoxypyridin-1-ium-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate chloride (PubChem CID 70449669) has the molecular formula C24H26ClN3O7S and a molecular weight of 536.01 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 6-[(1R)-1-hydroxyethyl]-3-[2-(3-methoxypyridin-1-ium-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate chloride.
| Compound Name | (4-nitrophenyl)methyl 6-[(1R)-1-hydroxyethyl]-3-[2-(3-methoxypyridin-1-ium-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate chloride |
|---|---|
| PubChem CID | 70449669 |
| Molecular Formula | C24H26ClN3O7S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | (4-nitrophenyl)methyl 6-[(1R)-1-hydroxyethyl]-3-[2-(3-methoxypyridin-1-ium-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate chloride |
| SMILES | COc1ccc[n+](CCSC2=C(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)C([C@@H](C)O)C3C2)c1.[Cl-] |
| InChI | InChI=1S/C24H26N3O7S.ClH/c1-15(28)21-19-12-20(35-11-10-25-9-3-4-18(13-25)33-2)22(26(19)23(21)29)24(30)34-14-16-5-7-17(8-6-16)27(31)32;/h3-9,13,15,19,21,28H,10-12,14H2,1-2H3;1H/q+1;/p-1/t15-,19?,21?;/m1./s1 |
| InChIKey | HGZKOCDHYTZKGL-IOAWTFOXSA-M |
| XLogP | -0.81 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|