C21H24N4O8S — CID 14581256
(4-nitrophenyl)methyl (5R,6R)-3-(2-acetamidoethylsulfanyl)-6-[methoxycarbonyl(methyl)amino]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 14581256) has the molecular formula C21H24N4O8S and a molecular weight of 492.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6R)-3-(2-acetamidoethylsulfanyl)-6-[methoxycarbonyl(methyl)amino]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6R)-3-(2-acetamidoethylsulfanyl)-6-[methoxycarbonyl(methyl)amino]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 14581256 |
| Molecular Formula | C21H24N4O8S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6R)-3-(2-acetamidoethylsulfanyl)-6-[methoxycarbonyl(methyl)amino]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | COC(=O)N(C)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(SCCNC(C)=O)C[C@H]12 |
| InChI | InChI=1S/C21H24N4O8S/c1-12(26)22-8-9-34-16-10-15-17(23(2)21(29)32-3)19(27)24(15)18(16)20(28)33-11-13-4-6-14(7-5-13)25(30)31/h4-7,15,17H,8-11H2,1-3H3,(H,22,26)/t15-,17-/m1/s1 |
| InChIKey | GHBLVJVTHMNMRH-NVXWUHKLSA-N |
| XLogP | 1.40 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|