C21H25NO5 — CID 10894009
benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-hydroxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 10894009) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-hydroxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-hydroxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 10894009 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-hydroxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CO[C@H]1CCC[C@H]2C1=C(C(=O)OCc1ccccc1)N1C(=O)[C@H]([C@@H](C)O)[C@@H]21 |
| InChI | InChI=1S/C21H25NO5/c1-12(23)16-18-14-9-6-10-15(26-2)17(14)19(22(18)20(16)24)21(25)27-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-16,18,23H,6,9-11H2,1-2H3/t12-,14+,15+,16-,18-/m1/s1 |
| InChIKey | IOEHHUKOUVMZKE-QGHZAEEISA-N |
| XLogP | 2.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |