C19H20INO5 — CID 59951138
1-(1-hydroxyethyl)-5-(2-iodophenoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 59951138) has the molecular formula C19H20INO5 and a molecular weight of 469.28 g/mol. Its IUPAC name is 1-(1-hydroxyethyl)-5-(2-iodophenoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | 1-(1-hydroxyethyl)-5-(2-iodophenoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 59951138 |
| Molecular Formula | C19H20INO5 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 1-(1-hydroxyethyl)-5-(2-iodophenoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | CC(O)C1C(=O)N2C(C(=O)O)=C3C(Oc4ccccc4I)CCCC3C12 |
| InChI | InChI=1S/C19H20INO5/c1-9(22)14-16-10-5-4-8-13(26-12-7-3-2-6-11(12)20)15(10)17(19(24)25)21(16)18(14)23/h2-3,6-7,9-10,13-14,16,22H,4-5,8H2,1H3,(H,24,25) |
| InChIKey | GGEKXMYUPRDJFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|