C17H25N3O6 — CID 67810030
(1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[2-hydroxyethylcarbamoyl(methyl)amino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 67810030) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[2-hydroxyethylcarbamoyl(methyl)amino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[2-hydroxyethylcarbamoyl(methyl)amino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 67810030 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[2-hydroxyethylcarbamoyl(methyl)amino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | CC(O)[C@H]1C(=O)N2C(C(=O)O)=C3[C@H](CCC[C@@H]3N(C)C(=O)NCCO)[C@H]12 |
| InChI | InChI=1S/C17H25N3O6/c1-8(22)11-13-9-4-3-5-10(19(2)17(26)18-6-7-21)12(9)14(16(24)25)20(13)15(11)23/h8-11,13,21-22H,3-7H2,1-2H3,(H,18,26)(H,24,25)/t8?,9-,10-,11+,13+/m0/s1 |
| InChIKey | GGPSSHGIPHOLHZ-BEWNUSPGSA-N |
| XLogP | -0.65 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |