C16H21ClN3NaO5 — CID 67810394
sodium (1S,5S,8aS,8bR)-5-(2-chloroethylcarbamoylamino)-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 67810394) has the molecular formula C16H21ClN3NaO5 and a molecular weight of 393.80 g/mol. Its IUPAC name is sodium (1S,5S,8aS,8bR)-5-(2-chloroethylcarbamoylamino)-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1S,5S,8aS,8bR)-5-(2-chloroethylcarbamoylamino)-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67810394 |
| Molecular Formula | C16H21ClN3NaO5 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | sodium (1S,5S,8aS,8bR)-5-(2-chloroethylcarbamoylamino)-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CC(O)[C@H]1C(=O)N2C(C(=O)[O-])=C3[C@@H](NC(=O)NCCCl)CCC[C@@H]3[C@H]12.[Na+] |
| InChI | InChI=1S/C16H22ClN3O5.Na/c1-7(21)10-12-8-3-2-4-9(19-16(25)18-6-5-17)11(8)13(15(23)24)20(12)14(10)22;/h7-10,12,21H,2-6H2,1H3,(H,23,24)(H2,18,19,25);/q;+1/p-1/t7?,8-,9-,10+,12+;/m0./s1 |
| InChIKey | MZEIDWCBAXCBMY-KXEVEMIXSA-M |
| XLogP | -4.08 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|