C15H19INNaO5 — CID 23680269
sodium (1S,5S,8aR,8bR)-1-[(1R)-1-hydroxyethyl]-5-(2-iodoethoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 23680269) has the molecular formula C15H19INNaO5 and a molecular weight of 443.21 g/mol. Its IUPAC name is sodium (1S,5S,8aR,8bR)-1-[(1R)-1-hydroxyethyl]-5-(2-iodoethoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1S,5S,8aR,8bR)-1-[(1R)-1-hydroxyethyl]-5-(2-iodoethoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 23680269 |
| Molecular Formula | C15H19INNaO5 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | sodium (1S,5S,8aR,8bR)-1-[(1R)-1-hydroxyethyl]-5-(2-iodoethoxy)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C3[C@@H](OCCI)CCC[C@H]3[C@H]12.[Na+] |
| InChI | InChI=1S/C15H20INO5.Na/c1-7(18)10-12-8-3-2-4-9(22-6-5-16)11(8)13(15(20)21)17(12)14(10)19;/h7-10,12,18H,2-6H2,1H3,(H,20,21);/q;+1/p-1/t7-,8-,9+,10-,12-;/m1./s1 |
| InChIKey | PIAQZNQOLOBJNM-PTSBBYLCSA-M |
| XLogP | -3.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|