C21H24N3NaO5S — CID 67807170
sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[(3-methylsulfanylphenyl)carbamoylamino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 67807170) has the molecular formula C21H24N3NaO5S and a molecular weight of 453.50 g/mol. Its IUPAC name is sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[(3-methylsulfanylphenyl)carbamoylamino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[(3-methylsulfanylphenyl)carbamoylamino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67807170 |
| Molecular Formula | C21H24N3NaO5S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-[(3-methylsulfanylphenyl)carbamoylamino]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CSc1cccc(NC(=O)N[C@H]2CCC[C@H]3C2=C(C(=O)[O-])N2C(=O)[C@H](C(C)O)[C@@H]32)c1.[Na+] |
| InChI | InChI=1S/C21H25N3O5S.Na/c1-10(25)15-17-13-7-4-8-14(16(13)18(20(27)28)24(17)19(15)26)23-21(29)22-11-5-3-6-12(9-11)30-2;/h3,5-6,9-10,13-15,17,25H,4,7-8H2,1-2H3,(H,27,28)(H2,22,23,29);/q;+1/p-1/t10?,13-,14-,15+,17+;/m0./s1 |
| InChIKey | SAQLLVCTOLAJRL-AQEOXNDNSA-M |
| XLogP | -2.07 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |