C13H16NO4- — CID 59951066
1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 59951066) has the molecular formula C13H16NO4- and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | 1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 59951066 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CC(O)C1C(=O)N2C(C(=O)[O-])=C3CCCCC3C12 |
| InChI | InChI=1S/C13H17NO4/c1-6(15)9-10-7-4-2-3-5-8(7)11(13(17)18)14(10)12(9)16/h6-7,9-10,15H,2-5H2,1H3,(H,17,18)/p-1 |
| InChIKey | OIBKKAKZIJGITQ-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |