C21H25N4NaO7S — CID 67809515
sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-2-oxo-5-[(4-sulfamoylphenyl)methylcarbamoylamino]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 67809515) has the molecular formula C21H25N4NaO7S and a molecular weight of 500.51 g/mol. Its IUPAC name is sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-2-oxo-5-[(4-sulfamoylphenyl)methylcarbamoylamino]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-2-oxo-5-[(4-sulfamoylphenyl)methylcarbamoylamino]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67809515 |
| Molecular Formula | C21H25N4NaO7S |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | sodium (1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-2-oxo-5-[(4-sulfamoylphenyl)methylcarbamoylamino]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CC(O)[C@H]1C(=O)N2C(C(=O)[O-])=C3[C@@H](NC(=O)NCc4ccc(S(N)(=O)=O)cc4)CCC[C@@H]3[C@H]12.[Na+] |
| InChI | InChI=1S/C21H26N4O7S.Na/c1-10(26)15-17-13-3-2-4-14(16(13)18(20(28)29)25(17)19(15)27)24-21(30)23-9-11-5-7-12(8-6-11)33(22,31)32;/h5-8,10,13-15,17,26H,2-4,9H2,1H3,(H,28,29)(H2,22,31,32)(H2,23,24,30);/q;+1/p-1/t10?,13-,14-,15+,17+;/m0./s1 |
| InChIKey | UOAFOMIPHSVXAW-AQEOXNDNSA-M |
| XLogP | -4.47 |
| TPSA | 181.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |