C17H27NO4Si — CID 67797404
(1R,2R,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5-azatricyclo[5.5.0.02,5]dodec-6-ene-6-carboxylic acid (PubChem CID 67797404) has the molecular formula C17H27NO4Si and a molecular weight of 337.49 g/mol. Its IUPAC name is (1R,2R,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5-azatricyclo[5.5.0.02,5]dodec-6-ene-6-carboxylic acid.
| Compound Name | (1R,2R,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5-azatricyclo[5.5.0.02,5]dodec-6-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 67797404 |
| Molecular Formula | C17H27NO4Si |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1R,2R,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5-azatricyclo[5.5.0.02,5]dodec-6-ene-6-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C3CCCCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C17H27NO4Si/c1-10(22-23(2,3)4)13-14-11-8-6-5-7-9-12(11)15(17(20)21)18(14)16(13)19/h10-11,13-14H,5-9H2,1-4H3,(H,20,21)/t10-,11-,13-,14-/m1/s1 |
| InChIKey | BZWJWWBHDCBJLA-HBJVGIJOSA-N |
| XLogP | 2.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|