C20H25NO4Si — CID 139819652
(10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2,4,6-tetraene-15-carboxylic acid (PubChem CID 139819652) has the molecular formula C20H25NO4Si and a molecular weight of 371.51 g/mol. Its IUPAC name is (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2,4,6-tetraene-15-carboxylic acid.
| Compound Name | (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2,4,6-tetraene-15-carboxylic acid |
|---|---|
| PubChem CID | 139819652 |
| Molecular Formula | C20H25NO4Si |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2,4,6-tetraene-15-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C3c4ccccc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H25NO4Si/c1-11(25-26(2,3)4)15-17-14-10-9-12-7-5-6-8-13(12)16(14)18(20(23)24)21(17)19(15)22/h5-8,11,14-15,17H,9-10H2,1-4H3,(H,23,24)/t11-,14-,15-,17-/m1/s1 |
| InChIKey | RUPKCCSMHYNXQY-BNGXUDDSSA-N |
| XLogP | 3.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|