C15H23NO6SSi — CID 67782276
2-oxo-2-[(3S,4S)-2-oxo-4-[(3S)-2-oxothian-3-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid (PubChem CID 67782276) has the molecular formula C15H23NO6SSi and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-oxo-2-[(3S,4S)-2-oxo-4-[(3S)-2-oxothian-3-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid.
| Compound Name | 2-oxo-2-[(3S,4S)-2-oxo-4-[(3S)-2-oxothian-3-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 67782276 |
| Molecular Formula | C15H23NO6SSi |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-oxo-2-[(3S,4S)-2-oxo-4-[(3S)-2-oxothian-3-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H]1C(=O)N(C(=O)C(=O)O)[C@@H]1[C@@H]1CCCSC1=O |
| InChI | InChI=1S/C15H23NO6SSi/c1-8(22-24(2,3)4)10-11(9-6-5-7-23-15(9)21)16(12(10)17)13(18)14(19)20/h8-11H,5-7H2,1-4H3,(H,19,20)/t8-,9+,10-,11-/m1/s1 |
| InChIKey | ZAEZOIKNASEUTP-LMLFDSFASA-N |
| XLogP | 1.33 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|