C23H33N3O4S2Si — CID 69421483
(4R,5S,6S)-3-[[4-[(2R)-1,2-dimethyl-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazol-2-yl]sulfanyl]-4-methyl-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 69421483) has the molecular formula C23H33N3O4S2Si and a molecular weight of 507.75 g/mol. Its IUPAC name is (4R,5S,6S)-3-[[4-[(2R)-1,2-dimethyl-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazol-2-yl]sulfanyl]-4-methyl-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-3-[[4-[(2R)-1,2-dimethyl-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazol-2-yl]sulfanyl]-4-methyl-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 69421483 |
| Molecular Formula | C23H33N3O4S2Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (4R,5S,6S)-3-[[4-[(2R)-1,2-dimethyl-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazol-2-yl]sulfanyl]-4-methyl-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H]1CC(c2csc(SC3=C(C(=O)O)N4C(=O)[C@H]([C@@H](C)O[Si](C)(C)C)[C@H]4[C@H]3C)n2)=CCN1C |
| InChI | InChI=1S/C23H33N3O4S2Si/c1-12-10-15(8-9-25(12)4)16-11-31-23(24-16)32-20-13(2)18-17(14(3)30-33(5,6)7)21(27)26(18)19(20)22(28)29/h8,11-14,17-18H,9-10H2,1-7H3,(H,28,29)/t12-,13-,14-,17-,18-/m1/s1 |
| InChIKey | DFPXMOWXMBLLFZ-GEYQNNLUSA-N |
| XLogP | 4.36 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|