C21H27N4O5S2+ — CID 11059873
(4R,5S,6S)-3-[[4-[1-(2-amino-2-oxoethyl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 11059873) has the molecular formula C21H27N4O5S2+ and a molecular weight of 479.60 g/mol. Its IUPAC name is (4R,5S,6S)-3-[[4-[1-(2-amino-2-oxoethyl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-3-[[4-[1-(2-amino-2-oxoethyl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 11059873 |
| Molecular Formula | C21H27N4O5S2+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (4R,5S,6S)-3-[[4-[1-(2-amino-2-oxoethyl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(Sc3nc(C4=CC[N+](C)(CC(N)=O)CC4)cs3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C21H26N4O5S2/c1-10-16-15(11(2)26)19(28)24(16)17(20(29)30)18(10)32-21-23-13(9-31-21)12-4-6-25(3,7-5-12)8-14(22)27/h4,9-11,15-16,26H,5-8H2,1-3H3,(H2-,22,27,29,30)/p+1/t10-,11-,15-,16-,25?/m1/s1 |
| InChIKey | KWQSDMRVNQQAAT-LIBAAXBVSA-O |
| XLogP | 1.11 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|