C18H24N3O4S2+ — CID 15894416
(4R,5S,6S)-3-[(5,5-dimethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 15894416) has the molecular formula C18H24N3O4S2+ and a molecular weight of 410.54 g/mol. Its IUPAC name is (4R,5S,6S)-3-[(5,5-dimethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-3-[(5,5-dimethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 15894416 |
| Molecular Formula | C18H24N3O4S2+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (4R,5S,6S)-3-[(5,5-dimethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(Sc3nc4c(s3)C[N+](C)(C)CC4)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C18H23N3O4S2/c1-8-13-12(9(2)22)16(23)20(13)14(17(24)25)15(8)27-18-19-10-5-6-21(3,4)7-11(10)26-18/h8-9,12-13,22H,5-7H2,1-4H3/p+1/t8-,9-,12-,13-/m1/s1 |
| InChIKey | RSZYTSBKZLDDAZ-NRMKKVEVSA-O |
| XLogP | 1.52 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|