C15H19N7O5S2 — CID 42629005
(4R,5S,6S)-3-[[3-[[2-(diaminomethylideneamino)acetyl]amino]-1,2,4-thiadiazol-5-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 42629005) has the molecular formula C15H19N7O5S2 and a molecular weight of 441.50 g/mol. Its IUPAC name is (4R,5S,6S)-3-[[3-[[2-(diaminomethylideneamino)acetyl]amino]-1,2,4-thiadiazol-5-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-3-[[3-[[2-(diaminomethylideneamino)acetyl]amino]-1,2,4-thiadiazol-5-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 42629005 |
| Molecular Formula | C15H19N7O5S2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (4R,5S,6S)-3-[[3-[[2-(diaminomethylideneamino)acetyl]amino]-1,2,4-thiadiazol-5-yl]sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(Sc3nc(NC(=O)CN=C(N)N)ns3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C15H19N7O5S2/c1-4-8-7(5(2)23)11(25)22(8)9(12(26)27)10(4)28-15-20-14(21-29-15)19-6(24)3-18-13(16)17/h4-5,7-8,23H,3H2,1-2H3,(H,26,27)(H4,16,17,18)(H,19,21,24)/t4-,5-,7-,8-/m1/s1 |
| InChIKey | WEWCMAYAQCUGAQ-SJNFNFGESA-N |
| XLogP | -1.00 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|