C21H33NO6SSi — CID 57094818
prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(3R)-4-oxothian-3-yl]azetidin-1-yl]-2-oxoacetate (PubChem CID 57094818) has the molecular formula C21H33NO6SSi and a molecular weight of 455.65 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(3R)-4-oxothian-3-yl]azetidin-1-yl]-2-oxoacetate.
| Compound Name | prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(3R)-4-oxothian-3-yl]azetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 57094818 |
| Molecular Formula | C21H33NO6SSi |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(3R)-4-oxothian-3-yl]azetidin-1-yl]-2-oxoacetate |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@H]1CSCCC1=O |
| InChI | InChI=1S/C21H33NO6SSi/c1-8-10-27-20(26)19(25)22-17(14-12-29-11-9-15(14)23)16(18(22)24)13(2)28-30(6,7)21(3,4)5/h8,13-14,16-17H,1,9-12H2,2-7H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | GIKFWMRZBSIQCI-YALNPMBYSA-N |
| XLogP | 2.80 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|