C29H44N2O8Si — CID 67791650
prop-2-enyl 3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxo-2-prop-2-enoxyacetyl)azetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 67791650) has the molecular formula C29H44N2O8Si and a molecular weight of 576.76 g/mol. Its IUPAC name is prop-2-enyl 3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxo-2-prop-2-enoxyacetyl)azetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxo-2-prop-2-enoxyacetyl)azetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67791650 |
| Molecular Formula | C29H44N2O8Si |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | prop-2-enyl 3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxo-2-prop-2-enoxyacetyl)azetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)C(C)=CC1CCN(C(=O)OCC=C)C1 |
| InChI | InChI=1S/C29H44N2O8Si/c1-10-14-37-27(35)26(34)31-22(24(25(31)33)20(4)39-40(8,9)29(5,6)7)17-23(32)19(3)16-21-12-13-30(18-21)28(36)38-15-11-2/h10-11,16,20-22,24H,1-2,12-15,17-18H2,3-9H3/t20-,21?,22-,24-/m1/s1 |
| InChIKey | MPKYWNGUYHUAMU-CMLWYQDPSA-N |
| XLogP | 4.03 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|