C29H39FeNO6SSi+2 — CID 45277917
CID 45277917 (PubChem CID 45277917) has the molecular formula C29H39FeNO6SSi+2 and a molecular weight of 613.63 g/mol.
| Compound Name | CID 45277917 |
|---|---|
| PubChem CID | 45277917 |
| Molecular Formula | C29H39FeNO6SSi+2 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)CC[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C24H34NO6SSi.C5H5.Fe/c1-8-15-30-23(29)21(28)25-20(27)19(16(2)31-33(6,7)24(3,4)5)22(25)32-18(26)14-13-17-11-9-10-12-17;1-2-4-5-3-1;/h8-12,16,19,22H,1,13-15H2,2-7H3;1-5H;/q;;+2/t16-,19+,22-;;/m1../s1 |
| InChIKey | YULUGHROOHMSCC-PNWXGYJXSA-N |
| XLogP | 4.90 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|