C19H31NO5Si — CID 102411898
prop-2-enyl (4R,5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 102411898) has the molecular formula C19H31NO5Si and a molecular weight of 381.55 g/mol. Its IUPAC name is prop-2-enyl (4R,5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (4R,5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 102411898 |
| Molecular Formula | C19H31NO5Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | prop-2-enyl (4R,5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C19H31NO5Si/c1-9-10-24-18(23)15-16(21)11(2)14-13(17(22)20(14)15)12(3)25-26(7,8)19(4,5)6/h9,11-15H,1,10H2,2-8H3/t11-,12-,13-,14-,15?/m1/s1 |
| InChIKey | UALGWROFNRVOIJ-AVBXVCIKSA-N |
| XLogP | 2.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|