C23H41NO4Si — CID 10550231
tert-butyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylazetidin-1-yl]pent-4-enoate (PubChem CID 10550231) has the molecular formula C23H41NO4Si and a molecular weight of 423.67 g/mol. Its IUPAC name is tert-butyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylazetidin-1-yl]pent-4-enoate.
| Compound Name | tert-butyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylazetidin-1-yl]pent-4-enoate |
|---|---|
| PubChem CID | 10550231 |
| Molecular Formula | C23H41NO4Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | tert-butyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylazetidin-1-yl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1CC=C |
| InChI | InChI=1S/C23H41NO4Si/c1-12-14-17-19(16(3)28-29(10,11)23(7,8)9)20(25)24(17)18(15-13-2)21(26)27-22(4,5)6/h12-13,16-19H,1-2,14-15H2,3-11H3/t16-,17-,18?,19-/m1/s1 |
| InChIKey | RMYIHDKYEZZPPJ-XGNHVKOBSA-N |
| XLogP | 5.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|