C22H33NO4Si — CID 101370654
benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-4-oxoazetidin-1-yl]acetate (PubChem CID 101370654) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-4-oxoazetidin-1-yl]acetate.
| Compound Name | benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 101370654 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-4-oxoazetidin-1-yl]acetate |
| SMILES | C=C[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33NO4Si/c1-8-18-20(16(2)27-28(6,7)22(3,4)5)21(25)23(18)14-19(24)26-15-17-12-10-9-11-13-17/h8-13,16,18,20H,1,14-15H2,2-7H3/t16-,18-,20-/m1/s1 |
| InChIKey | LQGJNOSBJWQSRR-YVWKXTFCSA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|