C35H42NO6PSi — CID 67648894
benzyl (4R,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-diphenylphosphoryloxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 67648894) has the molecular formula C35H42NO6PSi and a molecular weight of 631.78 g/mol. Its IUPAC name is benzyl (4R,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-diphenylphosphoryloxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | benzyl (4R,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-diphenylphosphoryloxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67648894 |
| Molecular Formula | C35H42NO6PSi |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | benzyl (4R,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-diphenylphosphoryloxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)OCc3ccccc3)=C(OP(=O)(c3ccccc3)c3ccccc3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C35H42NO6PSi/c1-24-30-29(25(2)42-44(6,7)35(3,4)5)33(37)36(30)31(34(38)40-23-26-17-11-8-12-18-26)32(24)41-43(39,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,24-25,29-30H,23H2,1-7H3/t24-,25?,29-,30-/m1/s1 |
| InChIKey | VYKLYMPVERTMRB-HPOOTQGSSA-N |
| XLogP | 6.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|