C25H26NO6P — CID 139711521
prop-2-enyl 3-diphenylphosphoryloxy-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 139711521) has the molecular formula C25H26NO6P and a molecular weight of 467.46 g/mol. Its IUPAC name is prop-2-enyl 3-diphenylphosphoryloxy-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl 3-diphenylphosphoryloxy-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139711521 |
| Molecular Formula | C25H26NO6P |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | prop-2-enyl 3-diphenylphosphoryloxy-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=C(OP(=O)(c2ccccc2)c2ccccc2)C(C)C2C(C(C)O)C(=O)N12 |
| InChI | InChI=1S/C25H26NO6P/c1-4-15-31-25(29)22-23(16(2)21-20(17(3)27)24(28)26(21)22)32-33(30,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h4-14,16-17,20-21,27H,1,15H2,2-3H3 |
| InChIKey | NJPKBCZTKQTPJT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|